ChemNet > CAS > 825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid
825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid
| Nama produk |
2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
| Nama Inggeris |
2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid; 2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid; 5-Methyl-2-norbornene-5-carboxylic Acid; (1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate; (1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| MF |
C9H11O2 |
| Berat Molekul |
151.183 |
| InChI |
InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1 |
| CAS NO |
825-03-6 |
| Struktur Molekul |
![825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid](https://images-a.chemnet.com/suppliers/chembase/468/46854.gif)
|
| Titik lebur |
83℃ |
| Titik didih |
261.352°C at 760 mmHg |
| Titik nyala |
121.096°C |
| Tekanan wap |
0.003mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
